C19H25ClN4O3 — CID 110346261
N-(3-chlorophenyl)-4-(5-oxo-1-propylpyrrolidine-3-carbonyl)piperazine-1-carboxamide (PubChem CID 110346261) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(5-oxo-1-propylpyrrolidine-3-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-(5-oxo-1-propylpyrrolidine-3-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110346261 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-(3-chlorophenyl)-4-(5-oxo-1-propylpyrrolidine-3-carbonyl)piperazine-1-carboxamide |
| SMILES | CCCN1CC(C(=O)N2CCN(C(=O)Nc3cccc(Cl)c3)CC2)CC1=O |
| InChI | InChI=1S/C19H25ClN4O3/c1-2-6-24-13-14(11-17(24)25)18(26)22-7-9-23(10-8-22)19(27)21-16-5-3-4-15(20)12-16/h3-5,12,14H,2,6-11,13H2,1H3,(H,21,27) |
| InChIKey | WNTPNSATICEJNY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |