C19H16N4O3S — CID 110351085
1-[2-[4-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethyl]-3-phenylurea (PubChem CID 110351085) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 1-[2-[4-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethyl]-3-phenylurea.
| Compound Name | 1-[2-[4-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 110351085 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-[2-[4-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethyl]-3-phenylurea |
| SMILES | O=C(NCCc1nc(-c2ccc3[nH]c(=O)oc3c2)cs1)Nc1ccccc1 |
| InChI | InChI=1S/C19H16N4O3S/c24-18(21-13-4-2-1-3-5-13)20-9-8-17-22-15(11-27-17)12-6-7-14-16(10-12)26-19(25)23-14/h1-7,10-11H,8-9H2,(H,23,25)(H2,20,21,24) |
| InChIKey | SPFRYPFWCARZBL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |