C17H38O3Si2 — CID 11035400
(3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pentanal (PubChem CID 11035400) has the molecular formula C17H38O3Si2 and a molecular weight of 346.66 g/mol. Its IUPAC name is (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pentanal.
| Compound Name | (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pentanal |
|---|---|
| PubChem CID | 11035400 |
| Molecular Formula | C17H38O3Si2 |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pentanal |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H38O3Si2/c1-14(19-21(8,9)16(2,3)4)15(12-13-18)20-22(10,11)17(5,6)7/h13-15H,12H2,1-11H3/t14-,15+/m0/s1 |
| InChIKey | RFELQBJZZVOBQC-LSDHHAIUSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|