C20H33FO2Si — CID 11035574
ethyl (4Z,8E)-4-fluoro-8-methyl-14-trimethylsilyltetradeca-4,8-dien-12-ynoate (PubChem CID 11035574) has the molecular formula C20H33FO2Si and a molecular weight of 352.57 g/mol. Its IUPAC name is ethyl (4Z,8E)-4-fluoro-8-methyl-14-trimethylsilyltetradeca-4,8-dien-12-ynoate.
| Compound Name | ethyl (4Z,8E)-4-fluoro-8-methyl-14-trimethylsilyltetradeca-4,8-dien-12-ynoate |
|---|---|
| PubChem CID | 11035574 |
| Molecular Formula | C20H33FO2Si |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | ethyl (4Z,8E)-4-fluoro-8-methyl-14-trimethylsilyltetradeca-4,8-dien-12-ynoate |
| SMILES | CCOC(=O)CC/C(F)=C/CC/C(C)=C/CCC#CC[Si](C)(C)C |
| InChI | InChI=1S/C20H33FO2Si/c1-6-23-20(22)16-15-19(21)14-11-13-18(2)12-9-7-8-10-17-24(3,4)5/h12,14H,6-7,9,11,13,15-17H2,1-5H3/b18-12+,19-14- |
| InChIKey | OATBTRJJJSOYOE-KQPRZUBISA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|