C16H14BrN3O2 — CID 110356755
1-(3-bromo-4-methylphenyl)-3-(2-methyl-1,3-benzoxazol-7-yl)urea (PubChem CID 110356755) has the molecular formula C16H14BrN3O2 and a molecular weight of 360.21 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-3-(2-methyl-1,3-benzoxazol-7-yl)urea.
| Compound Name | 1-(3-bromo-4-methylphenyl)-3-(2-methyl-1,3-benzoxazol-7-yl)urea |
|---|---|
| PubChem CID | 110356755 |
| Molecular Formula | C16H14BrN3O2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-3-(2-methyl-1,3-benzoxazol-7-yl)urea |
| SMILES | Cc1nc2cccc(NC(=O)Nc3ccc(C)c(Br)c3)c2o1 |
| InChI | InChI=1S/C16H14BrN3O2/c1-9-6-7-11(8-12(9)17)19-16(21)20-14-5-3-4-13-15(14)22-10(2)18-13/h3-8H,1-2H3,(H2,19,20,21) |
| InChIKey | YISITXOXMKSVCN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |