C10H8BrClN2O2 — CID 146094446
N-(5-bromo-2-methyl-1,3-benzoxazol-7-yl)-2-chloroacetamide (PubChem CID 146094446) has the molecular formula C10H8BrClN2O2 and a molecular weight of 303.54 g/mol. Its IUPAC name is N-(5-bromo-2-methyl-1,3-benzoxazol-7-yl)-2-chloroacetamide.
| Compound Name | N-(5-bromo-2-methyl-1,3-benzoxazol-7-yl)-2-chloroacetamide |
|---|---|
| PubChem CID | 146094446 |
| Molecular Formula | C10H8BrClN2O2 |
| Molecular Weight | 303.54 g/mol |
| Exact Mass | 301.95 |
| IUPAC Name | N-(5-bromo-2-methyl-1,3-benzoxazol-7-yl)-2-chloroacetamide |
| SMILES | Cc1nc2cc(Br)cc(NC(=O)CCl)c2o1 |
| InChI | InChI=1S/C10H8BrClN2O2/c1-5-13-7-2-6(11)3-8(10(7)16-5)14-9(15)4-12/h2-3H,4H2,1H3,(H,14,15) |
| InChIKey | QNHTYKTZMLCOBN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|