C16H12Cl2N2O3 — CID 110358515
3,6-dichloro-2-methoxy-N-(2-methyl-1,3-benzoxazol-7-yl)benzamide (PubChem CID 110358515) has the molecular formula C16H12Cl2N2O3 and a molecular weight of 351.19 g/mol. Its IUPAC name is 3,6-dichloro-2-methoxy-N-(2-methyl-1,3-benzoxazol-7-yl)benzamide.
| Compound Name | 3,6-dichloro-2-methoxy-N-(2-methyl-1,3-benzoxazol-7-yl)benzamide |
|---|---|
| PubChem CID | 110358515 |
| Molecular Formula | C16H12Cl2N2O3 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 3,6-dichloro-2-methoxy-N-(2-methyl-1,3-benzoxazol-7-yl)benzamide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)Nc1cccc2nc(C)oc12 |
| InChI | InChI=1S/C16H12Cl2N2O3/c1-8-19-11-4-3-5-12(15(11)23-8)20-16(21)13-9(17)6-7-10(18)14(13)22-2/h3-7H,1-2H3,(H,20,21) |
| InChIKey | RNILZSDPHUWTHV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |