C17H14Cl2N2O4 — CID 110291854
3,6-dichloro-2-methoxy-N-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)benzamide (PubChem CID 110291854) has the molecular formula C17H14Cl2N2O4 and a molecular weight of 381.22 g/mol. Its IUPAC name is 3,6-dichloro-2-methoxy-N-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)benzamide.
| Compound Name | 3,6-dichloro-2-methoxy-N-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)benzamide |
|---|---|
| PubChem CID | 110291854 |
| Molecular Formula | C17H14Cl2N2O4 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 3,6-dichloro-2-methoxy-N-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)benzamide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)Nc1cccc2c1OCC(=O)N2C |
| InChI | InChI=1S/C17H14Cl2N2O4/c1-21-12-5-3-4-11(16(12)25-8-13(21)22)20-17(23)14-9(18)6-7-10(19)15(14)24-2/h3-7H,8H2,1-2H3,(H,20,23) |
| InChIKey | OOUJSLRMIOVYQD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |