C15H19N3O4 — CID 110630403
1-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)-3-(oxan-4-yl)urea (PubChem CID 110630403) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)-3-(oxan-4-yl)urea.
| Compound Name | 1-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)-3-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 110630403 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)-3-(oxan-4-yl)urea |
| SMILES | CN1C(=O)COc2c(NC(=O)NC3CCOCC3)cccc21 |
| InChI | InChI=1S/C15H19N3O4/c1-18-12-4-2-3-11(14(12)22-9-13(18)19)17-15(20)16-10-5-7-21-8-6-10/h2-4,10H,5-9H2,1H3,(H2,16,17,20) |
| InChIKey | HNEKMAKSXORYHJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |