C14H9N5O2 — CID 168607716
2-[(4-methyl-3-oxo-1,4-benzoxazin-8-yl)amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607716) has the molecular formula C14H9N5O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-[(4-methyl-3-oxo-1,4-benzoxazin-8-yl)amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[(4-methyl-3-oxo-1,4-benzoxazin-8-yl)amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607716 |
| Molecular Formula | C14H9N5O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[(4-methyl-3-oxo-1,4-benzoxazin-8-yl)amino]ethene-1,1,2-tricarbonitrile |
| SMILES | CN1C(=O)COc2c(NC(C#N)=C(C#N)C#N)cccc21 |
| InChI | InChI=1S/C14H9N5O2/c1-19-12-4-2-3-10(14(12)21-8-13(19)20)18-11(7-17)9(5-15)6-16/h2-4,18H,8H2,1H3 |
| InChIKey | FDIFKRIKVSMECH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|