C11H15N3O4S — CID 110630398
8-(ethylsulfamoylamino)-4-methyl-1,4-benzoxazin-3-one (PubChem CID 110630398) has the molecular formula C11H15N3O4S and a molecular weight of 285.33 g/mol. Its IUPAC name is 8-(ethylsulfamoylamino)-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 8-(ethylsulfamoylamino)-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 110630398 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 8-(ethylsulfamoylamino)-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CCNS(=O)(=O)Nc1cccc2c1OCC(=O)N2C |
| InChI | InChI=1S/C11H15N3O4S/c1-3-12-19(16,17)13-8-5-4-6-9-11(8)18-7-10(15)14(9)2/h4-6,12-13H,3,7H2,1-2H3 |
| InChIKey | OOLXKHNZVSNDHL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |