C18H18N2O5 — CID 110291846
2,6-dimethoxy-N-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)benzamide (PubChem CID 110291846) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 2,6-dimethoxy-N-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)benzamide.
| Compound Name | 2,6-dimethoxy-N-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)benzamide |
|---|---|
| PubChem CID | 110291846 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2,6-dimethoxy-N-(4-methyl-3-oxo-1,4-benzoxazin-8-yl)benzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1cccc2c1OCC(=O)N2C |
| InChI | InChI=1S/C18H18N2O5/c1-20-12-7-4-6-11(17(12)25-10-15(20)21)19-18(22)16-13(23-2)8-5-9-14(16)24-3/h4-9H,10H2,1-3H3,(H,19,22) |
| InChIKey | KPIZTHQKZNIKDJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |