C11H11NO4 — CID 59153391
methyl 4-methyl-3-oxo-1,4-benzoxazine-8-carboxylate (PubChem CID 59153391) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is methyl 4-methyl-3-oxo-1,4-benzoxazine-8-carboxylate.
| Compound Name | methyl 4-methyl-3-oxo-1,4-benzoxazine-8-carboxylate |
|---|---|
| PubChem CID | 59153391 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | methyl 4-methyl-3-oxo-1,4-benzoxazine-8-carboxylate |
| SMILES | COC(=O)c1cccc2c1OCC(=O)N2C |
| InChI | InChI=1S/C11H11NO4/c1-12-8-5-3-4-7(11(14)15-2)10(8)16-6-9(12)13/h3-5H,6H2,1-2H3 |
| InChIKey | UVYQPYVFLNZDDX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |