C17H12Cl3NO2 — CID 70200090
2,4,6-trichloro-N-(2,3-dimethyl-1-benzofuran-7-yl)benzamide (PubChem CID 70200090) has the molecular formula C17H12Cl3NO2 and a molecular weight of 368.65 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(2,3-dimethyl-1-benzofuran-7-yl)benzamide.
| Compound Name | 2,4,6-trichloro-N-(2,3-dimethyl-1-benzofuran-7-yl)benzamide |
|---|---|
| PubChem CID | 70200090 |
| Molecular Formula | C17H12Cl3NO2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 2,4,6-trichloro-N-(2,3-dimethyl-1-benzofuran-7-yl)benzamide |
| SMILES | Cc1oc2c(NC(=O)c3c(Cl)cc(Cl)cc3Cl)cccc2c1C |
| InChI | InChI=1S/C17H12Cl3NO2/c1-8-9(2)23-16-11(8)4-3-5-14(16)21-17(22)15-12(19)6-10(18)7-13(15)20/h3-7H,1-2H3,(H,21,22) |
| InChIKey | NTMPSFPIMSLDDS-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |