About methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate
methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate (PubChem CID 110357612) has the molecular formula C17H25NO4
and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate |
| PubChem CID | 110357612 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)CCC(c1ccc(OC)c(OC)c1)C1CC1 |
| InChI | InChI=1S/C17H25NO4/c1-18(17(19)22-4)10-9-14(12-5-6-12)13-7-8-15(20-2)16(11-13)21-3/h7-8,11-12,14H,5-6,9-10H2,1-4H3 |
| InChIKey | ZWORVKBFFYUOOR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate?
The IUPAC name of methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate (CID 110357612) is methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate.
What is the SMILES notation for methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate?
The canonical SMILES for methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate is COC(=O)N(C)CCC(c1ccc(OC)c(OC)c1)C1CC1.
What is the InChIKey of methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate?
The InChIKey is ZWORVKBFFYUOOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4/c1-18(17(19)22-4)10-9-14(12-5-6-12)13-7-8-15(20-2)16(11-13)21-3/h7-8,11-12,14H,5-6,9-10H2,1-4H3.
What are the key properties of methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate?
methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate has a molecular weight of 307.39 g/mol, XLogP of 3.29, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[3-cyclopropyl-3-(3,4-dimethoxyphenyl)propyl]-N-methylcarbamate is sourced from PubChem (CID 110357612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).