C17H25NO4 — CID 110407527
3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)propanamide (PubChem CID 110407527) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 110407527 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CC(c1ccc(OC)c(OC)c1)C1CC1 |
| InChI | InChI=1S/C17H25NO4/c1-20-9-8-18-17(19)11-14(12-4-5-12)13-6-7-15(21-2)16(10-13)22-3/h6-7,10,12,14H,4-5,8-9,11H2,1-3H3,(H,18,19) |
| InChIKey | IDFYORCMKJQPBK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|