C22H28N2O3 — CID 110424660
3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]propanamide (PubChem CID 110424660) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]propanamide.
| Compound Name | 3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 110424660 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]propanamide |
| SMILES | COc1ccc(C(CC(=O)Nc2ccc(N(C)C)cc2)C2CC2)cc1OC |
| InChI | InChI=1S/C22H28N2O3/c1-24(2)18-10-8-17(9-11-18)23-22(25)14-19(15-5-6-15)16-7-12-20(26-3)21(13-16)27-4/h7-13,15,19H,5-6,14H2,1-4H3,(H,23,25) |
| InChIKey | VWJSIJQAPJIMGJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|