C22H28N2O3 — CID 110408995
3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-(3-pyridin-3-ylpropyl)propanamide (PubChem CID 110408995) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-(3-pyridin-3-ylpropyl)propanamide.
| Compound Name | 3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-(3-pyridin-3-ylpropyl)propanamide |
|---|---|
| PubChem CID | 110408995 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-cyclopropyl-3-(3,4-dimethoxyphenyl)-N-(3-pyridin-3-ylpropyl)propanamide |
| SMILES | COc1ccc(C(CC(=O)NCCCc2cccnc2)C2CC2)cc1OC |
| InChI | InChI=1S/C22H28N2O3/c1-26-20-10-9-18(13-21(20)27-2)19(17-7-8-17)14-22(25)24-12-4-6-16-5-3-11-23-15-16/h3,5,9-11,13,15,17,19H,4,6-8,12,14H2,1-2H3,(H,24,25) |
| InChIKey | KFSMKHRVPVTKRO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|