C29H34N2O5 — CID 23051246
2,2-bis(3,4-dimethoxyphenyl)-N-(4-pyridin-3-ylbutyl)cyclopropane-1-carboxamide (PubChem CID 23051246) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is 2,2-bis(3,4-dimethoxyphenyl)-N-(4-pyridin-3-ylbutyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-bis(3,4-dimethoxyphenyl)-N-(4-pyridin-3-ylbutyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 23051246 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 2,2-bis(3,4-dimethoxyphenyl)-N-(4-pyridin-3-ylbutyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(C2(c3ccc(OC)c(OC)c3)CC2C(=O)NCCCCc2cccnc2)cc1OC |
| InChI | InChI=1S/C29H34N2O5/c1-33-24-12-10-21(16-26(24)35-3)29(22-11-13-25(34-2)27(17-22)36-4)18-23(29)28(32)31-15-6-5-8-20-9-7-14-30-19-20/h7,9-14,16-17,19,23H,5-6,8,15,18H2,1-4H3,(H,31,32) |
| InChIKey | BGQKZAFHOBVQLI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|