C26H30N2O3 — CID 19858010
4-(3,4-dimethoxyphenyl)-3-ethyl-N-(4-pyridin-3-ylbutyl)benzamide (PubChem CID 19858010) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-3-ethyl-N-(4-pyridin-3-ylbutyl)benzamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-3-ethyl-N-(4-pyridin-3-ylbutyl)benzamide |
|---|---|
| PubChem CID | 19858010 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-3-ethyl-N-(4-pyridin-3-ylbutyl)benzamide |
| SMILES | CCc1cc(C(=O)NCCCCc2cccnc2)ccc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H30N2O3/c1-4-20-16-22(26(29)28-15-6-5-8-19-9-7-14-27-18-19)10-12-23(20)21-11-13-24(30-2)25(17-21)31-3/h7,9-14,16-18H,4-6,8,15H2,1-3H3,(H,28,29) |
| InChIKey | IURVNXMWLVUMPC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|