C28H34N2O3 — CID 14570110
3-butyl-4-(3,4-dimethoxyphenyl)-N-(4-pyridin-3-ylbutyl)benzamide (PubChem CID 14570110) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is 3-butyl-4-(3,4-dimethoxyphenyl)-N-(4-pyridin-3-ylbutyl)benzamide.
| Compound Name | 3-butyl-4-(3,4-dimethoxyphenyl)-N-(4-pyridin-3-ylbutyl)benzamide |
|---|---|
| PubChem CID | 14570110 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 3-butyl-4-(3,4-dimethoxyphenyl)-N-(4-pyridin-3-ylbutyl)benzamide |
| SMILES | CCCCc1cc(C(=O)NCCCCc2cccnc2)ccc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H34N2O3/c1-4-5-11-22-18-24(28(31)30-17-7-6-9-21-10-8-16-29-20-21)12-14-25(22)23-13-15-26(32-2)27(19-23)33-3/h8,10,12-16,18-20H,4-7,9,11,17H2,1-3H3,(H,30,31) |
| InChIKey | LOFIGYHGTRQLGU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|