C18H27N2O4S+ — CID 11035941
(Z)-1-(benzenesulfonyl)-2,6-dihydroxydodec-1-ene-1-diazonium (PubChem CID 11035941) has the molecular formula C18H27N2O4S+ and a molecular weight of 367.49 g/mol. Its IUPAC name is (Z)-1-(benzenesulfonyl)-2,6-dihydroxydodec-1-ene-1-diazonium.
| Compound Name | (Z)-1-(benzenesulfonyl)-2,6-dihydroxydodec-1-ene-1-diazonium |
|---|---|
| PubChem CID | 11035941 |
| Molecular Formula | C18H27N2O4S+ |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (Z)-1-(benzenesulfonyl)-2,6-dihydroxydodec-1-ene-1-diazonium |
| SMILES | CCCCCCC(O)CCC/C(O)=C(\[N+]#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O4S/c1-2-3-4-6-10-15(21)11-9-14-17(22)18(20-19)25(23,24)16-12-7-5-8-13-16/h5,7-8,12-13,15,21H,2-4,6,9-11,14H2,1H3/p+1/b18-17- |
| InChIKey | RCNFLPIBQLEXOW-ZCXUNETKSA-O |
| XLogP | 4.54 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|