C16H16F3N3O2S — CID 110359917
2,3,4-trifluoro-N-[[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]methyl]benzamide (PubChem CID 110359917) has the molecular formula C16H16F3N3O2S and a molecular weight of 371.38 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 110359917 |
| Molecular Formula | C16H16F3N3O2S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2,3,4-trifluoro-N-[[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1nc(CN2CCOCC2)cs1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H16F3N3O2S/c17-12-2-1-11(14(18)15(12)19)16(23)20-7-13-21-10(9-25-13)8-22-3-5-24-6-4-22/h1-2,9H,3-8H2,(H,20,23) |
| InChIKey | NHCBPMAOKDWPNK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|