C17H23N3O4S — CID 110364286
4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]morpholin-2-yl]-N,N-dimethylaniline (PubChem CID 110364286) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]morpholin-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]morpholin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 110364286 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]morpholin-2-yl]-N,N-dimethylaniline |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCOC(c2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C17H23N3O4S/c1-12-17(13(2)24-18-12)25(21,22)20-9-10-23-16(11-20)14-5-7-15(8-6-14)19(3)4/h5-8,16H,9-11H2,1-4H3 |
| InChIKey | OKPQORPCHPLTAL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|