C20H30O10 — CID 11037384
ethyl (E)-2-acetyloxy-3-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 11037384) has the molecular formula C20H30O10 and a molecular weight of 430.45 g/mol. Its IUPAC name is ethyl (E)-2-acetyloxy-3-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-2-acetyloxy-3-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11037384 |
| Molecular Formula | C20H30O10 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | ethyl (E)-2-acetyloxy-3-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\[C@H]1OC(C)(C)O[C@H]1[C@H](OC(C)=O)[C@H]1COC(C)(C)O1)OC(C)=O |
| InChI | InChI=1S/C20H30O10/c1-8-24-18(23)14(26-11(2)21)9-13-17(30-20(6,7)28-13)16(27-12(3)22)15-10-25-19(4,5)29-15/h9,13,15-17H,8,10H2,1-7H3/b14-9+/t13-,15-,16-,17-/m1/s1 |
| InChIKey | FOFRXHAQYSQARO-GCCAGIKASA-N |
| XLogP | 1.60 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|