C19H14ClFN2O3 — CID 110383114
N-(4-chlorophenyl)-1-[(2-fluorophenyl)methoxy]-2-oxopyridine-3-carboxamide (PubChem CID 110383114) has the molecular formula C19H14ClFN2O3 and a molecular weight of 372.78 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-[(2-fluorophenyl)methoxy]-2-oxopyridine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1-[(2-fluorophenyl)methoxy]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 110383114 |
| Molecular Formula | C19H14ClFN2O3 |
| Molecular Weight | 372.78 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N-(4-chlorophenyl)-1-[(2-fluorophenyl)methoxy]-2-oxopyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cccn(OCc2ccccc2F)c1=O |
| InChI | InChI=1S/C19H14ClFN2O3/c20-14-7-9-15(10-8-14)22-18(24)16-5-3-11-23(19(16)25)26-12-13-4-1-2-6-17(13)21/h1-11H,12H2,(H,22,24) |
| InChIKey | JZQGEBKOXZENLQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.78 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |