C19H16FN3O5S — CID 18560961
1-[(2-fluorophenyl)methoxy]-2-oxo-N-(4-sulfamoylphenyl)pyridine-3-carboxamide (PubChem CID 18560961) has the molecular formula C19H16FN3O5S and a molecular weight of 417.42 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methoxy]-2-oxo-N-(4-sulfamoylphenyl)pyridine-3-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methoxy]-2-oxo-N-(4-sulfamoylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 18560961 |
| Molecular Formula | C19H16FN3O5S |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 1-[(2-fluorophenyl)methoxy]-2-oxo-N-(4-sulfamoylphenyl)pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cccn(OCc3ccccc3F)c2=O)cc1 |
| InChI | InChI=1S/C19H16FN3O5S/c20-17-6-2-1-4-13(17)12-28-23-11-3-5-16(19(23)25)18(24)22-14-7-9-15(10-8-14)29(21,26)27/h1-11H,12H2,(H,22,24)(H2,21,26,27) |
| InChIKey | OQMQDSZIWZJLHK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |