C14H16N2O2S — CID 110383761
N-cyclopentyl-5-(2-methyl-1,3-thiazol-4-yl)furan-2-carboxamide (PubChem CID 110383761) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-cyclopentyl-5-(2-methyl-1,3-thiazol-4-yl)furan-2-carboxamide.
| Compound Name | N-cyclopentyl-5-(2-methyl-1,3-thiazol-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110383761 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-cyclopentyl-5-(2-methyl-1,3-thiazol-4-yl)furan-2-carboxamide |
| SMILES | Cc1nc(-c2ccc(C(=O)NC3CCCC3)o2)cs1 |
| InChI | InChI=1S/C14H16N2O2S/c1-9-15-11(8-19-9)12-6-7-13(18-12)14(17)16-10-4-2-3-5-10/h6-8,10H,2-5H2,1H3,(H,16,17) |
| InChIKey | CHSKQLAOEHTBSR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |