C16H11N3O2S — CID 110383906
N-(3-cyanophenyl)-5-(2-methyl-1,3-thiazol-4-yl)furan-2-carboxamide (PubChem CID 110383906) has the molecular formula C16H11N3O2S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-(3-cyanophenyl)-5-(2-methyl-1,3-thiazol-4-yl)furan-2-carboxamide.
| Compound Name | N-(3-cyanophenyl)-5-(2-methyl-1,3-thiazol-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110383906 |
| Molecular Formula | C16H11N3O2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-(3-cyanophenyl)-5-(2-methyl-1,3-thiazol-4-yl)furan-2-carboxamide |
| SMILES | Cc1nc(-c2ccc(C(=O)Nc3cccc(C#N)c3)o2)cs1 |
| InChI | InChI=1S/C16H11N3O2S/c1-10-18-13(9-22-10)14-5-6-15(21-14)16(20)19-12-4-2-3-11(7-12)8-17/h2-7,9H,1H3,(H,19,20) |
| InChIKey | ZSPWCPQKVAHHOR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |