C30H51NO5 — CID 11038467
[(2S,4Z,7Z)-1-[(2S,3S)-3-(5-methylhexyl)-4-oxooxetan-2-yl]trideca-4,7-dien-2-yl] (2S)-2-formamido-4-methylpentanoate (PubChem CID 11038467) has the molecular formula C30H51NO5 and a molecular weight of 505.74 g/mol. Its IUPAC name is [(2S,4Z,7Z)-1-[(2S,3S)-3-(5-methylhexyl)-4-oxooxetan-2-yl]trideca-4,7-dien-2-yl] (2S)-2-formamido-4-methylpentanoate.
| Compound Name | [(2S,4Z,7Z)-1-[(2S,3S)-3-(5-methylhexyl)-4-oxooxetan-2-yl]trideca-4,7-dien-2-yl] (2S)-2-formamido-4-methylpentanoate |
|---|---|
| PubChem CID | 11038467 |
| Molecular Formula | C30H51NO5 |
| Molecular Weight | 505.74 g/mol |
| Exact Mass | 505.38 |
| IUPAC Name | [(2S,4Z,7Z)-1-[(2S,3S)-3-(5-methylhexyl)-4-oxooxetan-2-yl]trideca-4,7-dien-2-yl] (2S)-2-formamido-4-methylpentanoate |
| SMILES | CCCCC/C=C\C/C=C\C[C@@H](C[C@@H]1OC(=O)[C@H]1CCCCC(C)C)OC(=O)[C@H](CC(C)C)NC=O |
| InChI | InChI=1S/C30H51NO5/c1-6-7-8-9-10-11-12-13-14-18-25(35-30(34)27(31-22-32)20-24(4)5)21-28-26(29(33)36-28)19-16-15-17-23(2)3/h10-11,13-14,22-28H,6-9,12,15-21H2,1-5H3,(H,31,32)/b11-10-,14-13-/t25-,26-,27-,28-/m0/s1 |
| InChIKey | FLFPAKILCFIPHT-CEFULKORSA-N |
| XLogP | 6.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.74 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|