C29H51NO4 — CID 125427498
[(2R,4E,7E)-1-[(2S,3R)-3-hexyl-4-oxooxetan-2-yl]trideca-4,7-dien-2-yl] (2S,3S)-3-methyl-2-(methylamino)pentanoate (PubChem CID 125427498) has the molecular formula C29H51NO4 and a molecular weight of 477.73 g/mol. Its IUPAC name is [(2R,4E,7E)-1-[(2S,3R)-3-hexyl-4-oxooxetan-2-yl]trideca-4,7-dien-2-yl] (2S,3S)-3-methyl-2-(methylamino)pentanoate.
| Compound Name | [(2R,4E,7E)-1-[(2S,3R)-3-hexyl-4-oxooxetan-2-yl]trideca-4,7-dien-2-yl] (2S,3S)-3-methyl-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 125427498 |
| Molecular Formula | C29H51NO4 |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 477.38 |
| IUPAC Name | [(2R,4E,7E)-1-[(2S,3R)-3-hexyl-4-oxooxetan-2-yl]trideca-4,7-dien-2-yl] (2S,3S)-3-methyl-2-(methylamino)pentanoate |
| SMILES | CCCCC/C=C/C/C=C/C[C@H](C[C@@H]1OC(=O)[C@@H]1CCCCCC)OC(=O)[C@@H](NC)[C@@H](C)CC |
| InChI | InChI=1S/C29H51NO4/c1-6-9-11-13-14-15-16-17-18-20-24(33-29(32)27(30-5)23(4)8-3)22-26-25(28(31)34-26)21-19-12-10-7-2/h14-15,17-18,23-27,30H,6-13,16,19-22H2,1-5H3/b15-14+,18-17+/t23-,24+,25+,26-,27-/m0/s1 |
| InChIKey | MNDDAZUTOZCWFG-ABFYFYCMSA-N |
| XLogP | 6.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|