C19H31NO5 — CID 173122462
1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hept-5-en-2-yl 2-formamidoacetate (PubChem CID 173122462) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hept-5-en-2-yl 2-formamidoacetate.
| Compound Name | 1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hept-5-en-2-yl 2-formamidoacetate |
|---|---|
| PubChem CID | 173122462 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hept-5-en-2-yl 2-formamidoacetate |
| SMILES | CC=CCCC(C[C@@H]1OC(=O)[C@H]1CCCCCC)OC(=O)CNC=O |
| InChI | InChI=1S/C19H31NO5/c1-3-5-7-9-11-16-17(25-19(16)23)12-15(10-8-6-4-2)24-18(22)13-20-14-21/h4,6,14-17H,3,5,7-13H2,1-2H3,(H,20,21)/t15?,16-,17-/m0/s1 |
| InChIKey | YEWKKVDDJYHYSQ-BSOSBYQFSA-N |
| XLogP | 2.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|