C14H15N5OS — CID 110384682
N-(2,6-diethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide (PubChem CID 110384682) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
|---|---|
| PubChem CID | 110384682 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(2,6-diethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1nn2cnnc2s1 |
| InChI | InChI=1S/C14H15N5OS/c1-3-9-6-5-7-10(4-2)11(9)16-12(20)13-18-19-8-15-17-14(19)21-13/h5-8H,3-4H2,1-2H3,(H,16,20) |
| InChIKey | HBGZJHZDWRJWHS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |