C27H42O6SSi — CID 11038659
(2S,4aS,5R,7R,8aS)-5-(benzenesulfonylmethyl)-2-tert-butyl-7-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-6-methylidene-5,7,8,8a-tetrahydrobenzo[d][1,3]dioxin-4-one (PubChem CID 11038659) has the molecular formula C27H42O6SSi and a molecular weight of 522.78 g/mol. Its IUPAC name is (2S,4aS,5R,7R,8aS)-5-(benzenesulfonylmethyl)-2-tert-butyl-7-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-6-methylidene-5,7,8,8a-tetrahydrobenzo[d][1,3]dioxin-4-one.
| Compound Name | (2S,4aS,5R,7R,8aS)-5-(benzenesulfonylmethyl)-2-tert-butyl-7-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-6-methylidene-5,7,8,8a-tetrahydrobenzo[d][1,3]dioxin-4-one |
|---|---|
| PubChem CID | 11038659 |
| Molecular Formula | C27H42O6SSi |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | (2S,4aS,5R,7R,8aS)-5-(benzenesulfonylmethyl)-2-tert-butyl-7-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-6-methylidene-5,7,8,8a-tetrahydrobenzo[d][1,3]dioxin-4-one |
| SMILES | C=C1[C@@H](CS(=O)(=O)c2ccccc2)[C@]2(C)C(=O)O[C@@H](C(C)(C)C)O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H42O6SSi/c1-18-20(17-34(29,30)19-14-12-11-13-15-19)27(8)22(31-24(25(2,3)4)32-23(27)28)16-21(18)33-35(9,10)26(5,6)7/h11-15,20-22,24H,1,16-17H2,2-10H3/t20-,21-,22+,24+,27+/m1/s1 |
| InChIKey | GMDFNCZYVZUHCA-IVTQMCRDSA-N |
| XLogP | 5.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|