C24H36O6SSi — CID 134979512
(2S,4aS,7R,8aS)-5-(benzenesulfonylmethyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,4a-dimethyl-6-methylidene-5,7,8,8a-tetrahydrobenzo[d][1,3]dioxin-4-one (PubChem CID 134979512) has the molecular formula C24H36O6SSi and a molecular weight of 480.70 g/mol. Its IUPAC name is (2S,4aS,7R,8aS)-5-(benzenesulfonylmethyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,4a-dimethyl-6-methylidene-5,7,8,8a-tetrahydrobenzo[d][1,3]dioxin-4-one.
| Compound Name | (2S,4aS,7R,8aS)-5-(benzenesulfonylmethyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,4a-dimethyl-6-methylidene-5,7,8,8a-tetrahydrobenzo[d][1,3]dioxin-4-one |
|---|---|
| PubChem CID | 134979512 |
| Molecular Formula | C24H36O6SSi |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (2S,4aS,7R,8aS)-5-(benzenesulfonylmethyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,4a-dimethyl-6-methylidene-5,7,8,8a-tetrahydrobenzo[d][1,3]dioxin-4-one |
| SMILES | C=C1C(CS(=O)(=O)c2ccccc2)[C@]2(C)C(=O)O[C@@H](C)O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H36O6SSi/c1-16-19(15-31(26,27)18-12-10-9-11-13-18)24(6)21(28-17(2)29-22(24)25)14-20(16)30-32(7,8)23(3,4)5/h9-13,17,19-21H,1,14-15H2,2-8H3/t17-,19?,20+,21-,24-/m0/s1 |
| InChIKey | RNLJBUFSQSGSSK-NCBNRORJSA-N |
| XLogP | 4.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|