C38H60O8SSi — CID 10395012
ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-[tert-butyl(dimethyl)silyl]oxy-2,5,11-trimethyldodeca-4,6,10-trienoate (PubChem CID 10395012) has the molecular formula C38H60O8SSi and a molecular weight of 705.04 g/mol. Its IUPAC name is ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-[tert-butyl(dimethyl)silyl]oxy-2,5,11-trimethyldodeca-4,6,10-trienoate.
| Compound Name | ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-[tert-butyl(dimethyl)silyl]oxy-2,5,11-trimethyldodeca-4,6,10-trienoate |
|---|---|
| PubChem CID | 10395012 |
| Molecular Formula | C38H60O8SSi |
| Molecular Weight | 705.04 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-[tert-butyl(dimethyl)silyl]oxy-2,5,11-trimethyldodeca-4,6,10-trienoate |
| SMILES | CCOC(=O)[C@@](C)(C/C=C(C)/C=C/CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)[C@H]1C[C@@H](CC(=O)CS(=O)(=O)c2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C38H60O8SSi/c1-12-43-35(40)38(9,24-23-29(2)19-15-13-16-20-30(3)27-44-48(10,11)36(4,5)6)34-26-32(45-37(7,8)46-34)25-31(39)28-47(41,42)33-21-17-14-18-22-33/h14-15,17-23,32,34H,12-13,16,24-28H2,1-11H3/b19-15+,29-23+,30-20+/t32-,34-,38+/m1/s1 |
| InChIKey | DZRXMSJLTXOQDM-DLTWWQEKSA-N |
| XLogP | 8.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.04 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|