C12H15N3O4S — CID 110387791
1-methylsulfonyl-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 110387791) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 1-methylsulfonyl-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-methylsulfonyl-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110387791 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-methylsulfonyl-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)N1C(=O)CCC1C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C12H15N3O4S/c1-20(18,19)15-10(5-6-11(15)16)12(17)14-8-9-4-2-3-7-13-9/h2-4,7,10H,5-6,8H2,1H3,(H,14,17) |
| InChIKey | MTOPIRZLWBOMTB-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |