C9H16N2O5S — CID 110387766
N-(2-methoxyethyl)-1-methylsulfonyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 110387766) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-methylsulfonyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-methylsulfonyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110387766 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-(2-methoxyethyl)-1-methylsulfonyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)C1CCC(=O)N1S(C)(=O)=O |
| InChI | InChI=1S/C9H16N2O5S/c1-16-6-5-10-9(13)7-3-4-8(12)11(7)17(2,14)15/h7H,3-6H2,1-2H3,(H,10,13) |
| InChIKey | JAOFGCMHSSXJEN-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|