C14H9BrN2O2 — CID 110388234
N-(2-bromophenyl)-1,3-benzoxazole-5-carboxamide (PubChem CID 110388234) has the molecular formula C14H9BrN2O2 and a molecular weight of 317.14 g/mol. Its IUPAC name is N-(2-bromophenyl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-(2-bromophenyl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 110388234 |
| Molecular Formula | C14H9BrN2O2 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | N-(2-bromophenyl)-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C14H9BrN2O2/c15-10-3-1-2-4-11(10)17-14(18)9-5-6-13-12(7-9)16-8-19-13/h1-8H,(H,17,18) |
| InChIKey | MPCBUAUUPRXVNT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |