C41H54O3 — CID 11039245
[[(5R,8Z,11Z,14Z)-5-(methoxymethoxy)icosa-8,11,14-trienoxy]-diphenylmethyl]benzene (PubChem CID 11039245) has the molecular formula C41H54O3 and a molecular weight of 594.88 g/mol. Its IUPAC name is [[(5R,8Z,11Z,14Z)-5-(methoxymethoxy)icosa-8,11,14-trienoxy]-diphenylmethyl]benzene.
| Compound Name | [[(5R,8Z,11Z,14Z)-5-(methoxymethoxy)icosa-8,11,14-trienoxy]-diphenylmethyl]benzene |
|---|---|
| PubChem CID | 11039245 |
| Molecular Formula | C41H54O3 |
| Molecular Weight | 594.88 g/mol |
| Exact Mass | 594.41 |
| IUPAC Name | [[(5R,8Z,11Z,14Z)-5-(methoxymethoxy)icosa-8,11,14-trienoxy]-diphenylmethyl]benzene |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC[C@@H](CCCCOC(c1ccccc1)(c1ccccc1)c1ccccc1)OCOC |
| InChI | InChI=1S/C41H54O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-24-33-40(43-36-42-2)34-25-26-35-44-41(37-27-18-15-19-28-37,38-29-20-16-21-30-38)39-31-22-17-23-32-39/h7-8,10-11,13-23,27-32,40H,3-6,9,12,24-26,33-36H2,1-2H3/b8-7-,11-10-,14-13-/t40-/m0/s1 |
| InChIKey | PAGJHHRJRMBBMB-CQAXTQFZSA-N |
| XLogP | 10.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.88 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|