C22H38O4 — CID 11100651
(5S,8Z,11Z,14Z)-5-(methoxymethoxy)icosa-8,11,14-trienoic acid (PubChem CID 11100651) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is (5S,8Z,11Z,14Z)-5-(methoxymethoxy)icosa-8,11,14-trienoic acid.
| Compound Name | (5S,8Z,11Z,14Z)-5-(methoxymethoxy)icosa-8,11,14-trienoic acid |
|---|---|
| PubChem CID | 11100651 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | (5S,8Z,11Z,14Z)-5-(methoxymethoxy)icosa-8,11,14-trienoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC[C@H](CCCC(=O)O)OCOC |
| InChI | InChI=1S/C22H38O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-21(26-20-25-2)18-16-19-22(23)24/h7-8,10-11,13-14,21H,3-6,9,12,15-20H2,1-2H3,(H,23,24)/b8-7-,11-10-,14-13-/t21-/m1/s1 |
| InChIKey | CKFYUAISNPUPGB-SGPMWKSLSA-N |
| XLogP | 6.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|