About carbon monoxide;4-diphenylphosphanylphenol;tungsten
carbon monoxide;4-diphenylphosphanylphenol;tungsten (PubChem CID 11039303) has the molecular formula C23H15O6PW
and a molecular weight of 602.18 g/mol. Its IUPAC name is carbon monoxide;4-diphenylphosphanylphenol;tungsten.
Molecular Properties
| Compound Name | carbon monoxide;4-diphenylphosphanylphenol;tungsten |
| PubChem CID | 11039303 |
| Molecular Formula | C23H15O6PW |
| Molecular Weight | 602.18 g/mol |
| Exact Mass | 602.01 |
| IUPAC Name | carbon monoxide;4-diphenylphosphanylphenol;tungsten |
| SMILES | Oc1ccc(P(c2ccccc2)c2ccccc2)cc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W] |
| InChI | InChI=1S/C18H15OP.5CO.W/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;5*1-2;/h1-14,19H;;;;;; |
| InChIKey | WFCMLPCUUQMKBX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 602.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;4-diphenylphosphanylphenol;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;4-diphenylphosphanylphenol;tungsten?
The IUPAC name of carbon monoxide;4-diphenylphosphanylphenol;tungsten (CID 11039303) is carbon monoxide;4-diphenylphosphanylphenol;tungsten.
What is the SMILES notation for carbon monoxide;4-diphenylphosphanylphenol;tungsten?
The canonical SMILES for carbon monoxide;4-diphenylphosphanylphenol;tungsten is Oc1ccc(P(c2ccccc2)c2ccccc2)cc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W].
What is the InChIKey of carbon monoxide;4-diphenylphosphanylphenol;tungsten?
The InChIKey is WFCMLPCUUQMKBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15OP.5CO.W/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;5*1-2;/h1-14,19H;;;;;;.
What are the key properties of carbon monoxide;4-diphenylphosphanylphenol;tungsten?
carbon monoxide;4-diphenylphosphanylphenol;tungsten has a molecular weight of 602.18 g/mol, XLogP of 2.96, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;4-diphenylphosphanylphenol;tungsten is sourced from PubChem (CID 11039303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).