carbon monoxide;4-diphenylphosphanylphenol;tungsten

C23H15O6PW — CID 11039303

IUPACcarbon monoxide;4-diphenylphosphanylphenol;tungsten
SMILESOc1ccc(P(c2ccccc2)c2ccccc2)cc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W]
InChIInChI=1S/C18H15OP.5CO.W/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;5*1-2;/h1-14,19H;;;;;;
InChIKeyWFCMLPCUUQMKBX-UHFFFAOYSA-N
MW602.18 g/mol
LogP2.96
Rot. Bonds3

About carbon monoxide;4-diphenylphosphanylphenol;tungsten

carbon monoxide;4-diphenylphosphanylphenol;tungsten (PubChem CID 11039303) has the molecular formula C23H15O6PW and a molecular weight of 602.18 g/mol. Its IUPAC name is carbon monoxide;4-diphenylphosphanylphenol;tungsten.

Molecular Properties

Compound Namecarbon monoxide;4-diphenylphosphanylphenol;tungsten
PubChem CID11039303
Molecular FormulaC23H15O6PW
Molecular Weight602.18 g/mol
Exact Mass602.01
IUPAC Namecarbon monoxide;4-diphenylphosphanylphenol;tungsten
SMILESOc1ccc(P(c2ccccc2)c2ccccc2)cc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W]
InChIInChI=1S/C18H15OP.5CO.W/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;5*1-2;/h1-14,19H;;;;;;
InChIKeyWFCMLPCUUQMKBX-UHFFFAOYSA-N
XLogP2.96
TPSA119.73 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms31
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500602.18
LogP ≤ 52.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze carbon monoxide;4-diphenylphosphanylphenol;tungsten with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;4-diphenylphosphanylphenol;tungsten?
The IUPAC name of carbon monoxide;4-diphenylphosphanylphenol;tungsten (CID 11039303) is carbon monoxide;4-diphenylphosphanylphenol;tungsten.
What is the SMILES notation for carbon monoxide;4-diphenylphosphanylphenol;tungsten?
The canonical SMILES for carbon monoxide;4-diphenylphosphanylphenol;tungsten is Oc1ccc(P(c2ccccc2)c2ccccc2)cc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W].
What is the InChIKey of carbon monoxide;4-diphenylphosphanylphenol;tungsten?
The InChIKey is WFCMLPCUUQMKBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15OP.5CO.W/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;5*1-2;/h1-14,19H;;;;;;.
What are the key properties of carbon monoxide;4-diphenylphosphanylphenol;tungsten?
carbon monoxide;4-diphenylphosphanylphenol;tungsten has a molecular weight of 602.18 g/mol, XLogP of 2.96, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;4-diphenylphosphanylphenol;tungsten is sourced from PubChem (CID 11039303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).