About 1,1'-biphenyl;phenol;triphenylphosphane
1,1'-biphenyl;phenol;triphenylphosphane (PubChem CID 173130424) has the molecular formula C36H31OP
and a molecular weight of 510.62 g/mol. Its IUPAC name is 1,1'-biphenyl;phenol;triphenylphosphane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;phenol;triphenylphosphane |
| PubChem CID | 173130424 |
| Molecular Formula | C36H31OP |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 1,1'-biphenyl;phenol;triphenylphosphane |
| SMILES | Oc1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C12H10.C6H6O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6/h1-15H;1-10H;1-5,7H |
| InChIKey | MZJABPBYPUWFRX-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;phenol;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;phenol;triphenylphosphane?
The IUPAC name of 1,1'-biphenyl;phenol;triphenylphosphane (CID 173130424) is 1,1'-biphenyl;phenol;triphenylphosphane.
What is the SMILES notation for 1,1'-biphenyl;phenol;triphenylphosphane?
The canonical SMILES for 1,1'-biphenyl;phenol;triphenylphosphane is Oc1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;phenol;triphenylphosphane?
The InChIKey is MZJABPBYPUWFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C12H10.C6H6O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6/h1-15H;1-10H;1-5,7H.
What are the key properties of 1,1'-biphenyl;phenol;triphenylphosphane?
1,1'-biphenyl;phenol;triphenylphosphane has a molecular weight of 510.62 g/mol, XLogP of 8.19, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;phenol;triphenylphosphane is sourced from PubChem (CID 173130424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).