C17H18FNO3S2 — CID 110394259
(4-fluoro-3-methylphenyl)-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone (PubChem CID 110394259) has the molecular formula C17H18FNO3S2 and a molecular weight of 367.47 g/mol. Its IUPAC name is (4-fluoro-3-methylphenyl)-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone.
| Compound Name | (4-fluoro-3-methylphenyl)-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 110394259 |
| Molecular Formula | C17H18FNO3S2 |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | (4-fluoro-3-methylphenyl)-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)ccc1F |
| InChI | InChI=1S/C17H18FNO3S2/c1-12-11-14(4-5-15(12)18)17(20)13-6-8-19(9-7-13)24(21,22)16-3-2-10-23-16/h2-5,10-11,13H,6-9H2,1H3 |
| InChIKey | DXMLDBQERNSWTM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |