C14H17N5O4S2 — CID 110400983
2,5-dimethoxy-N-[2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide (PubChem CID 110400983) has the molecular formula C14H17N5O4S2 and a molecular weight of 383.46 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110400983 |
| Molecular Formula | C14H17N5O4S2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2,5-dimethoxy-N-[2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCc2nn3c(C)nnc3s2)c1 |
| InChI | InChI=1S/C14H17N5O4S2/c1-9-16-17-14-19(9)18-13(24-14)6-7-15-25(20,21)12-8-10(22-2)4-5-11(12)23-3/h4-5,8,15H,6-7H2,1-3H3 |
| InChIKey | QQZQSAXWHJJNAH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |