C15H13F2N5OS — CID 110405401
(3,4-difluorophenyl)-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)piperidin-1-yl]methanone (PubChem CID 110405401) has the molecular formula C15H13F2N5OS and a molecular weight of 349.37 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)piperidin-1-yl]methanone.
| Compound Name | (3,4-difluorophenyl)-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110405401 |
| Molecular Formula | C15H13F2N5OS |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | (3,4-difluorophenyl)-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1CCC(c2nn3cnnc3s2)CC1 |
| InChI | InChI=1S/C15H13F2N5OS/c16-11-2-1-10(7-12(11)17)14(23)21-5-3-9(4-6-21)13-20-22-8-18-19-15(22)24-13/h1-2,7-9H,3-6H2 |
| InChIKey | WCHFURPUBLOHMJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |