C16H15Cl2N5OS — CID 110405257
(3,4-dichlorophenyl)-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)piperidin-1-yl]methanone (PubChem CID 110405257) has the molecular formula C16H15Cl2N5OS and a molecular weight of 396.30 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)piperidin-1-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110405257 |
| Molecular Formula | C16H15Cl2N5OS |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | (3,4-dichlorophenyl)-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)piperidin-1-yl]methanone |
| SMILES | Cc1nnc2sc(C3CCN(C(=O)c4ccc(Cl)c(Cl)c4)CC3)nn12 |
| InChI | InChI=1S/C16H15Cl2N5OS/c1-9-19-20-16-23(9)21-14(25-16)10-4-6-22(7-5-10)15(24)11-2-3-12(17)13(18)8-11/h2-3,8,10H,4-7H2,1H3 |
| InChIKey | MLSZBSRWZSFRPR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |