C20H23FN2O2 — CID 110408878
N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 110408878) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 110408878 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | CC1(C)COCCN1c1ccc(NC(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H23FN2O2/c1-20(2)14-25-12-11-23(20)18-9-7-17(8-10-18)22-19(24)13-15-3-5-16(21)6-4-15/h3-10H,11-14H2,1-2H3,(H,22,24) |
| InChIKey | NXYXZAMVIZMLRC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |