C13H20N2O3S — CID 110637672
N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]methanesulfonamide (PubChem CID 110637672) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 110637672 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]methanesulfonamide |
| SMILES | CC1(C)COCCN1c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H20N2O3S/c1-13(2)10-18-9-8-15(13)12-6-4-11(5-7-12)14-19(3,16)17/h4-7,14H,8-10H2,1-3H3 |
| InChIKey | AJHUEGSQICVILF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |