C18H23NO3S2 — CID 110410538
3-[(2-methylphenoxy)methyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine (PubChem CID 110410538) has the molecular formula C18H23NO3S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 3-[(2-methylphenoxy)methyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine.
| Compound Name | 3-[(2-methylphenoxy)methyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 110410538 |
| Molecular Formula | C18H23NO3S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-[(2-methylphenoxy)methyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(COc3ccccc3C)C2)s1 |
| InChI | InChI=1S/C18H23NO3S2/c1-14-6-3-4-8-17(14)22-13-16-7-5-11-19(12-16)24(20,21)18-10-9-15(2)23-18/h3-4,6,8-10,16H,5,7,11-13H2,1-2H3 |
| InChIKey | PSDSQILOOOSZAM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |